cas: 50702-37-9 — see every product listed under this CAS number, including other names
3-Iodobenzenesulfonic acid, 95% (CAS 50702-37-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A536930-100mg |
| cas | 50702-37-9 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 766.57 Pln | |
| AmBeed | 5g | 6163.36 Pln | |
| AmBeed | 10g | 10225.60 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-iodobenzenesulfonic acid (CAS 50702-37-9) is a chemical compound with the molecular formula C6H5IO3S and a molecular weight of 284.07 g/mol. IUPAC name: 3-iodobenzenesulfonic acid. InChIKey: BNQPGPMRORGVHG-UHFFFAOYSA-N.
| Molecular formula | C6H5IO3S |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 3-iodobenzenesulfonic acid |
| InChIKey | BNQPGPMRORGVHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)S(=O)(=O)O |
Computed by PubChem (NCBI)