cas: 885276-26-6 — see every product listed under this CAS number, including other names
3-Iodoimidazo[1,2-a]pyridine-8-carbonitrile, 98%, 98% (CAS 885276-26-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GS4Q-100mg |
| cas | 885276-26-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1130.00 Pln | |
| Chemat | 250mg | 1595.60 Pln | |
| Chemat | 1g | 4202.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-iodoimidazo[1,2-a]pyridine-8-carbonitrile (CAS 885276-26-6) is a chemical compound with the molecular formula C8H4IN3 and a molecular weight of 269.04 g/mol. IUPAC name: 3-iodoimidazo[1,2-a]pyridine-8-carbonitrile. InChIKey: RNUCRHBDTAKEPR-UHFFFAOYSA-N.
| Molecular formula | C8H4IN3 |
|---|---|
| Molecular weight | 269.04 g/mol |
| IUPAC name | 3-iodoimidazo[1,2-a]pyridine-8-carbonitrile |
| InChIKey | RNUCRHBDTAKEPR-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=C1)C#N)I |
Computed by PubChem (NCBI)