cas: 64965-48-6 — see every product listed under this CAS number, including other names
3-Iodoquinolin-4-ol (CAS 64965-48-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F364061-1G |
| cas | 64965-48-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 747.67 Pln |
| delivery time | 2-3 weeks |
|---|
3-iodo-1H-quinolin-4-one (CAS 64965-48-6) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 3-iodo-1H-quinolin-4-one. InChIKey: HZBSJOAFGNZACW-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 3-iodo-1H-quinolin-4-one |
| InChIKey | HZBSJOAFGNZACW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CN2)I |
Computed by PubChem (NCBI)