CAS 78208-73-8 appears in our catalog under these names: 3-Isopropyl-1-methyl-1h-pyrazole-5-carboxylic acid, 97%, 1-Methyl-3-(1-methylethyl)-1H-pyrazole-5-carboxylic acid, 99%, 99%, 3-Isopropyl-1-methyl-1H-pyrazole-5-carboxylic acid, 99%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
1-methyl-3-propan-2-ylpyrazole-5-carboxylic acid (CAS 78208-73-8) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: 1-methyl-3-propan-2-ylpyrazole-5-carboxylic acid. InChIKey: FJPHBZNCWOYBDN-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 1-methyl-3-propan-2-ylpyrazole-5-carboxylic acid |
| InChIKey | FJPHBZNCWOYBDN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=C1)C(=O)O)C |
Computed by PubChem (NCBI)