cas: 1486485-62-4 — see every product listed under this CAS number, including other names
3-METHYL-1-(OXAN-2-YL)PYRAZOLE-5-BORONIC ACID PINACOL ESTER, 98% (CAS 1486485-62-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F837053-250MG |
| cas | 1486485-62-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 1913.93 Pln | |
| Fluorochem | 10g | 3205.14 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-methyl-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1486485-62-4) is a chemical compound with the molecular formula C15H25BN2O3 and a molecular weight of 292.18 g/mol. IUPAC name: 3-methyl-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: ATJGEGCXZOEOJQ-UHFFFAOYSA-N.
| Molecular formula | C15H25BN2O3 |
|---|---|
| Molecular weight | 292.18 g/mol |
| IUPAC name | 3-methyl-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | ATJGEGCXZOEOJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NN2C3CCCCO3)C |
Computed by PubChem (NCBI)