CAS 1469753-39-6 appears in our catalog under these names: 3-Mesityl-5,6,7,8-tetrahydro-4H-cyclohepta[d]thiazol-3-ium chloride, 97%, 97%, 3-Mesityl-5,6,7,8-tetrahydro-4H-cyclohepta[d]thiazol-3-ium chloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium chloride (CAS 1469753-39-6) is a chemical compound with the molecular formula C17H22ClNS and a molecular weight of 307.9 g/mol. IUPAC name: 3-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium chloride. InChIKey: WUNHRUHQQKKPHE-UHFFFAOYSA-M.
| Molecular formula | C17H22ClNS |
|---|---|
| Molecular weight | 307.9 g/mol |
| IUPAC name | 3-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-3-ium chloride |
| InChIKey | WUNHRUHQQKKPHE-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)[N+]2=CSC3=C2CCCCC3)C.[Cl-] |
Computed by PubChem (NCBI)