cas: 1190206-49-5 — see every product listed under this CAS number, including other names
3-Methyl-2-(methylthio)pyridine-5-boronic acid (CAS 1190206-49-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627878-1G |
| cas | 1190206-49-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4387.01 Pln | |
| Fluorochem | 5g | 13040.22 Pln |
| delivery time | 3-4 weeks |
|---|
(5-methyl-6-methylsulfanyl-3-pyridinyl)boronic acid (CAS 1190206-49-5) is a chemical compound with the molecular formula C7H10BNO2S and a molecular weight of 183.04 g/mol. IUPAC name: (5-methyl-6-methylsulfanyl-3-pyridinyl)boronic acid. InChIKey: RVNBIKYOMOKNLZ-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO2S |
|---|---|
| Molecular weight | 183.04 g/mol |
| IUPAC name | (5-methyl-6-methylsulfanyl-3-pyridinyl)boronic acid |
| InChIKey | RVNBIKYOMOKNLZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)SC)C)(O)O |
Computed by PubChem (NCBI)