cas: 2304635-16-1 — see every product listed under this CAS number, including other names
3-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 98% (CAS 2304635-16-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 50mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A813860-5g |
| cas | 2304635-16-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 28395.01 Pln | |
| AmBeed | 1g | 8109.85 Pln | |
| AmBeed | 50mg | 1326.43 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole (CAS 2304635-16-1) is a chemical compound with the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. IUPAC name: 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole. InChIKey: UTTCUANLWOYIFF-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2 |
|---|---|
| Molecular weight | 258.13 g/mol |
| IUPAC name | 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole |
| InChIKey | UTTCUANLWOYIFF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC3=NNC(=C23)C |
Computed by PubChem (NCBI)