3-Methyl-4-(o-tolyloxy)aniline, 95+%
cas: 860573-00-8 — see every product listed under this CAS number, including other names
3-Methyl-4-(o-tolyloxy)aniline, 95+% (CAS 860573-00-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A876836-100mg |
| cas | 860573-00-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 2328.38 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 814.18 Pln | |
| BLDpharm | 5g | 2285.89 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 2152.40 Pln | |
| Fluorochem | 5g | 3980.91 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 1414.10 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
3-methyl-4-(2-methylphenoxy)aniline (CAS 860573-00-8) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 3-methyl-4-(2-methylphenoxy)aniline. InChIKey: KMJOAOYCGNYUPW-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 3-methyl-4-(2-methylphenoxy)aniline |
| InChIKey | KMJOAOYCGNYUPW-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=C(C=C(C=C2)N)C |
Computed by PubChem (NCBI)