cas: 27116-80-9 — see every product listed under this CAS number, including other names
3-Methyl-4-nitro-5-(trifluoromethyl)-1H-pyrazole, 95%, 95% (CAS 27116-80-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCOW-100mg |
| cas | 27116-80-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1643.60 Pln | |
| Chemat | 10g | 2699.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-methyl-4-nitro-3-(trifluoromethyl)-1H-pyrazole (CAS 27116-80-9) is a chemical compound with the molecular formula C5H4F3N3O2 and a molecular weight of 195.10 g/mol. IUPAC name: 5-methyl-4-nitro-3-(trifluoromethyl)-1H-pyrazole. InChIKey: MZVQCTATYLWIQA-UHFFFAOYSA-N.
| Molecular formula | C5H4F3N3O2 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 5-methyl-4-nitro-3-(trifluoromethyl)-1H-pyrazole |
| InChIKey | MZVQCTATYLWIQA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)