cas: 10477-94-8 — see every product listed under this CAS number, including other names
3-Methyl-5-phenylpyridine, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 10477-94-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JQB-1g |
| cas | 10477-94-8 |
| size | 1g |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 731.60 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
3-methyl-5-phenylpyridine (CAS 10477-94-8) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 3-methyl-5-phenylpyridine. InChIKey: VPFKZMSXKPTQJG-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 3-methyl-5-phenylpyridine |
| InChIKey | VPFKZMSXKPTQJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)