cas: 1227911-51-4 — see every product listed under this CAS number, including other names
3-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 98%, 98% (CAS 1227911-51-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JGM-100mg |
| cas | 1227911-51-4 |
| size | 100mg |
| availability | 13g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 1768.40 Pln | |
| Chemat | 10g | 2891.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole (CAS 1227911-51-4) is a chemical compound with the molecular formula C14H19BN2O2 and a molecular weight of 258.13 g/mol. IUPAC name: 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole. InChIKey: CHLPEMGHRXSNAA-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O2 |
|---|---|
| Molecular weight | 258.13 g/mol |
| IUPAC name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole |
| InChIKey | CHLPEMGHRXSNAA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NNC(=C3C=C2)C |
Computed by PubChem (NCBI)