cas: 942070-28-2 — see every product listed under this CAS number, including other names
3-Methylthiophene-2,5-diboronic acid, pinacol ester, 96%, 96% (CAS 942070-28-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHZ4-250mg |
| cas | 942070-28-2 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 2200.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane (CAS 942070-28-2) is a chemical compound with the molecular formula C17H28B2O4S and a molecular weight of 350.1 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane. InChIKey: NOPYKVMGHVNISZ-UHFFFAOYSA-N.
| Molecular formula | C17H28B2O4S |
|---|---|
| Molecular weight | 350.1 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane |
| InChIKey | NOPYKVMGHVNISZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(S2)B3OC(C(O3)(C)C)(C)C)C |
Computed by PubChem (NCBI)