cas: 115551-46-7 — see every product listed under this CAS number, including other names
3-N-Cbz-aminopyrrolidine, 97%, 97% (CAS 115551-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111G69-250mg |
| cas | 115551-46-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 846.80 Pln | |
| Chemat | 100mg | 107.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-pyrrolidin-3-ylcarbamate (CAS 115551-46-7) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: benzyl N-pyrrolidin-3-ylcarbamate. InChIKey: DSOICHFMGRBFCM-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | benzyl N-pyrrolidin-3-ylcarbamate |
| InChIKey | DSOICHFMGRBFCM-UHFFFAOYSA-N |
| SMILES | C1CNCC1NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)