cas: 619-23-8 — see every product listed under this CAS number, including other names
3-Nitrobenzyl Chloride, >99.0%(GC) (CAS 619-23-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C0709-5G |
| cas | 619-23-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 272.27 Pln | |
| TCI | 25g | 798.42 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
1-(chloromethyl)-3-nitrobenzene (CAS 619-23-8) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 1-(chloromethyl)-3-nitrobenzene. InChIKey: APGGSERFJKEWFG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 1-(chloromethyl)-3-nitrobenzene |
| InChIKey | APGGSERFJKEWFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CCl |
Computed by PubChem (NCBI)