cas: 38240-29-8 — see every product listed under this CAS number, including other names
3-Nitropyridine-2-thiol, 98%, 98% (CAS 38240-29-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JTX-100mg |
| cas | 38240-29-8 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 626.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-nitro-1H-pyridine-2-thione (CAS 38240-29-8) is a chemical compound with the molecular formula C5H4N2O2S and a molecular weight of 156.16 g/mol. IUPAC name: 3-nitro-1H-pyridine-2-thione. InChIKey: LKNPLDRVWHXGKZ-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O2S |
|---|---|
| Molecular weight | 156.16 g/mol |
| IUPAC name | 3-nitro-1H-pyridine-2-thione |
| InChIKey | LKNPLDRVWHXGKZ-UHFFFAOYSA-N |
| SMILES | C1=CNC(=S)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)