cas: 1818294-33-5 — see every product listed under this CAS number, including other names
3-Oxo-1-(Pyridin-2-yldisulfaneyl)-7,10,13,16,19,22-hexaoxa-4-azapentacosan-25-oic acid, 98%, 98% (CAS 1818294-33-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120DZA-50mg |
| cas | 1818294-33-5 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 237.20 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1480.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1818294-33-5) is a chemical compound with the molecular formula C23H38N2O9S2 and a molecular weight of 550.7 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: FVYCUTAHKAPGJJ-UHFFFAOYSA-N.
| Molecular formula | C23H38N2O9S2 |
|---|---|
| Molecular weight | 550.7 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | FVYCUTAHKAPGJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SSCCC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)