3-Oxo-1-phenyl-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid, 95%
cas: 1334177-87-5 — see every product listed under this CAS number, including other names
3-Oxo-1-phenyl-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid, 95% (CAS 1334177-87-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD00882825-250mg |
| cas | 1334177-87-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 250mg | 319.91 Pln | |
| BLDpharm | 1g | 969.68 Pln | |
| BLDpharm | 5g | 3368.84 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 2066.00 Pln | |
| Chemat | 10g | 3270.80 Pln | |
| Fluorochem | 5g | 3225.97 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 305.12 Pln | |
| Fluorochem | 1g | 929.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334177-87-5) is a chemical compound with the molecular formula C27H45NO12 and a molecular weight of 575.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ISVOBOLHCFBPFZ-UHFFFAOYSA-N.
| Molecular formula | C27H45NO12 |
|---|---|
| Molecular weight | 575.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ISVOBOLHCFBPFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Cbz-N-amido-PEG8-acid, Cbz-NH-PEG8-C2-acid, 3-Oxo-1-phenyl-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid, CBZ-NH-PEG8-acid, Cbz-N-amido-PEG8-COOH, CbzNH-PEG8-CH2CH2COOH, 7-Tosylate, orb1909435, 3-[2-[2-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy], 3-Oxo-1-phenyl-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oicacid