cas: 785-74-0 — see every product listed under this CAS number, including other names
3-Oxo-N-(3-trifluoromethyl-phenyl)-butyramide (CAS 785-74-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060623-1G |
| cas | 785-74-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 674.78 Pln | |
| Fluorochem | 2g | 924.69 Pln |
| delivery time | 2-3 weeks |
|---|
3-oxo-N-[3-(trifluoromethyl)phenyl]butanamide (CAS 785-74-0) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: 3-oxo-N-[3-(trifluoromethyl)phenyl]butanamide. InChIKey: YOTPJLYOOXQHKX-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | 3-oxo-N-[3-(trifluoromethyl)phenyl]butanamide |
| InChIKey | YOTPJLYOOXQHKX-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)