cas: 1309981-45-0 — see every product listed under this CAS number, including other names
3-Phenoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 97% (CAS 1309981-45-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158244-10g |
| cas | 1309981-45-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2873.50 Pln | |
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1816.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A158244 |
3-phenoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1309981-45-0) is a chemical compound with the molecular formula C17H20BNO3 and a molecular weight of 297.2 g/mol. IUPAC name: 3-phenoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: ILWVNBOVBBBNEL-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO3 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 3-phenoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | ILWVNBOVBBBNEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)