cas: 252873-46-4 — see every product listed under this CAS number, including other names
3-Phenoxybenzene-1-sulfonyl chloride 95% (CAS 252873-46-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A574868-50mg |
| cas | 252873-46-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 331.44 Pln | |
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 2100.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A574868 |
3-phenoxybenzenesulfonyl chloride (CAS 252873-46-4) is a chemical compound with the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. IUPAC name: 3-phenoxybenzenesulfonyl chloride. InChIKey: JXJUPXKGJUPDHK-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO3S |
|---|---|
| Molecular weight | 268.72 g/mol |
| IUPAC name | 3-phenoxybenzenesulfonyl chloride |
| InChIKey | JXJUPXKGJUPDHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)