cas: 118468-17-0 — see every product listed under this CAS number, including other names
3-Phenoxyphenethylamine, 97% (CAS 118468-17-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018949-500MG |
| cas | 118468-17-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1174.60 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5355.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-phenoxyphenyl)ethanamine (CAS 118468-17-0) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 2-(3-phenoxyphenyl)ethanamine. InChIKey: CNALSZKXQUFGDN-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 2-(3-phenoxyphenyl)ethanamine |
| InChIKey | CNALSZKXQUFGDN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)CCN |
Computed by PubChem (NCBI)