cas: 1171891-07-8 — see every product listed under this CAS number, including other names
3-Phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95% (CAS 1171891-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696350-100MG |
| cas | 1171891-07-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 5g | 3840.33 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1171891-07-8) is a chemical compound with the molecular formula C17H20BNO2 and a molecular weight of 281.2 g/mol. IUPAC name: 3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: NWFQXEHKPNULNY-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 3-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | NWFQXEHKPNULNY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)