3-Phenyl-5-(trifluoromethyl)-1H-pyrazol-4-amine, 95%
cas: 824969-30-4 — see every product listed under this CAS number, including other names
3-Phenyl-5-(trifluoromethyl)-1H-pyrazol-4-amine, 95% (CAS 824969-30-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1599186-250mg |
| cas | 824969-30-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 948.88 Pln | |
| Ambeed | 5g | 3134.94 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 442.09 Pln | |
| BLDpharm | 1g | 1019.67 Pln | |
| BLDpharm | 5g | 3374.39 Pln | |
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2474.00 Pln | |
| Fluorochem | 1g | 1393.28 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-phenyl-5-(trifluoromethyl)-1H-pyrazol-4-amine (CAS 824969-30-4) is a chemical compound with the molecular formula C10H8F3N3 and a molecular weight of 227.19 g/mol. IUPAC name: 3-phenyl-5-(trifluoromethyl)-1H-pyrazol-4-amine. InChIKey: ZZDLEUWFIMWDHL-UHFFFAOYSA-N.
| Molecular formula | C10H8F3N3 |
|---|---|
| Molecular weight | 227.19 g/mol |
| IUPAC name | 3-phenyl-5-(trifluoromethyl)-1H-pyrazol-4-amine |
| InChIKey | ZZDLEUWFIMWDHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=C2N)C(F)(F)F |
Computed by PubChem (NCBI)