cas: 306935-14-8 — see every product listed under this CAS number, including other names
3-Phenyl-5-piperazino-1,2,4-thiadiazole, 97% (CAS 306935-14-8) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | HAN00371CB |
| cas | 306935-14-8 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 570.17 Pln | |
| Thermo Scientific | 1g | 1018.16 Pln | |
| Thermo Scientific | 5g | 3965.73 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-phenyl-5-piperazin-1-yl-1,2,4-thiadiazole (CAS 306935-14-8) is a chemical compound with the molecular formula C12H14N4S and a molecular weight of 246.33 g/mol. IUPAC name: 3-phenyl-5-piperazin-1-yl-1,2,4-thiadiazole. InChIKey: UMFMHSLRNJBGKO-UHFFFAOYSA-N.
| Molecular formula | C12H14N4S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 3-phenyl-5-piperazin-1-yl-1,2,4-thiadiazole |
| InChIKey | UMFMHSLRNJBGKO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC(=NS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)