cas: 194805-04-4 — see every product listed under this CAS number, including other names
3-Quinolinecarboxylic acid,7-bromo-1-cyclopropyl-1,4-dihydro-8-methyl-4-oxo-, ethyl ester, 97%, 97% (CAS 194805-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTQ7-100mg |
| cas | 194805-04-4 |
| size | 100mg |
| availability | 8.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2541.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 7-bromo-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate (CAS 194805-04-4) is a chemical compound with the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. IUPAC name: ethyl 7-bromo-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate. InChIKey: NSAIANPWRHILKT-UHFFFAOYSA-N.
| Molecular formula | C16H16BrNO3 |
|---|---|
| Molecular weight | 350.21 g/mol |
| IUPAC name | ethyl 7-bromo-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate |
| InChIKey | NSAIANPWRHILKT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C2=C(C1=O)C=CC(=C2C)Br)C3CC3 |
Computed by PubChem (NCBI)