CAS 129746-42-5 appears in our catalog under these names: 3–(Thiophen–3–yl)benzaldehyde, 3-(Thiophen-3-yl)benzaldehyde 95%, 3-THIEN-3-YLBENZALDEHYDE, 95%, 95%, 3-Thiophen-3-yl-benzaldehyde, ≥95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 25mg, 5g.
3-thiophen-3-ylbenzaldehyde (CAS 129746-42-5) is a chemical compound with the molecular formula C11H8OS and a molecular weight of 188.25 g/mol. IUPAC name: 3-thiophen-3-ylbenzaldehyde. InChIKey: HOQKGZHXQLZFBT-UHFFFAOYSA-N.
| Molecular formula | C11H8OS |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | 3-thiophen-3-ylbenzaldehyde |
| InChIKey | HOQKGZHXQLZFBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CSC=C2)C=O |
Computed by PubChem (NCBI)