cas: 135-97-7 — see every product listed under this CAS number, including other names
3-exo-8-Methyl-8-azabicyclo[3.2.1]octan-3-ol, 98% (CAS 135-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215980-250MG |
| cas | 135-97-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 706.02 Pln | |
| Fluorochem | 100g | 2590.77 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tropine is a derivative of tropane having a hydroxy group at the 3-position. It has a role as a mouse metabolite. It is a conjugate base of a tropinium.
Source: ChEBI
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| InChIKey | CYHOMWAPJJPNMW-DHBOJHSNSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)O |
Computed by PubChem (NCBI)