cas: 23210-22-2 — see every product listed under this CAS number, including other names
3-methyl-1-phenyl-2,3-dihydro-1H-indol-2-one, 95%, 95% (CAS 23210-22-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113MJJ-50mg |
| cas | 23210-22-2 |
| size | 50mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 266.00 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 1g | 2032.40 Pln | |
| Chemat | 5g | 2738.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-methyl-1-phenyl-3H-indol-2-one (CAS 23210-22-2) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 3-methyl-1-phenyl-3H-indol-2-one. InChIKey: DJKASMOURATDIE-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 3-methyl-1-phenyl-3H-indol-2-one |
| InChIKey | DJKASMOURATDIE-UHFFFAOYSA-N |
| SMILES | CC1C2=CC=CC=C2N(C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)