3-methyl-1-vinyl-1H-imidazolium methyl sulphate, 98%, 98%
cas: 26591-72-0 — see every product listed under this CAS number, including other names
3-methyl-1-vinyl-1H-imidazolium methyl sulphate, 98%, 98% (CAS 26591-72-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113TTB-1g |
| cas | 26591-72-0 |
| size | 1g |
| availability | 43g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 784.40 Pln | |
| Chemat | 10g | 1235.60 Pln | |
| Chemat | 25g | 2267.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-ethenyl-3-methylimidazol-3-ium;methyl sulfate (CAS 26591-72-0) is a chemical compound with the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. IUPAC name: 1-ethenyl-3-methylimidazol-3-ium;methyl sulfate. InChIKey: BZVFPIHTRLNAQA-UHFFFAOYSA-M.
| Molecular formula | C7H12N2O4S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 1-ethenyl-3-methylimidazol-3-ium;methyl sulfate |
| InChIKey | BZVFPIHTRLNAQA-UHFFFAOYSA-M |
| SMILES | C[N+]1=CN(C=C1)C=C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
3-Methyl-1-vinyl-1H-imidazolium methyl sulphate, 1H-Imidazolium, 1-ethenyl-3-methyl-, methyl sulfate, 1-Vinylimidazole dimethyl sulfate quaternary salt, 3-Methyl-N-vinylimidazolium methyl sulfate, 1-ethenyl-3-methyl-1h-imidazol-3-ium methyl sulfate, 3-Methyl-1-vinyl-1H-imidazol-3-ium methyl sulfate, 3-methyl-1-vinylimidazolium methyl sulfate, 1-ethenyl-3-methylimidazol-3-ium;methyl sulfate, 1-methyl-3-vinyl-1H-imidazol-3-ium methyl sulfate, BZVFPIHTRLNAQA-UHFFFAOYSA-M