cas: 10345-87-6 — see every product listed under this CAS number, including other names
3-phenylcyclohex-2-en-1-one, 97%, 97% (CAS 10345-87-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11036Q-100mg |
| cas | 10345-87-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 582.80 Pln | |
| Chemat | 1g | 1360.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-phenylcyclohex-2-en-1-one (CAS 10345-87-6) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: 3-phenylcyclohex-2-en-1-one. InChIKey: DIELDZAPFMXAHA-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | 3-phenylcyclohex-2-en-1-one |
| InChIKey | DIELDZAPFMXAHA-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)