cas: 862368-62-5 — see every product listed under this CAS number, including other names
3-tert-Butyl-1-(pyridin-2-yl)-1H-pyrazol-5-amine 95% (CAS 862368-62-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1123789-100mg |
| cas | 862368-62-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 670.75 Pln | |
| Ambeed | 1g | 1210.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1123789 |
3-tert-butyl-1-pyridin-2-ylpyrazol-5-amine (CAS 862368-62-5) is a chemical compound with the molecular formula C12H16N4 and a molecular weight of 216.28 g/mol. IUPAC name: 3-tert-butyl-1-pyridin-2-ylpyrazol-5-amine. InChIKey: GUULKYKPJKFSFK-UHFFFAOYSA-N.
| Molecular formula | C12H16N4 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 3-tert-butyl-1-pyridin-2-ylpyrazol-5-amine |
| InChIKey | GUULKYKPJKFSFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=CC=CC=N2 |
Computed by PubChem (NCBI)