CAS 74975-88-5 is the registry number for 4'-(Trifluoromethyl)-2,3,4,5-tetrahydro-1,1'-biphenyl, 95%. Offered by: Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg.
1-(cyclohexen-1-yl)-4-(trifluoromethyl)benzene (CAS 74975-88-5) is a chemical compound with the molecular formula C13H13F3 and a molecular weight of 226.24 g/mol. IUPAC name: 1-(cyclohexen-1-yl)-4-(trifluoromethyl)benzene. InChIKey: ZHWZIUOJISTCRY-UHFFFAOYSA-N.
| Molecular formula | C13H13F3 |
|---|---|
| Molecular weight | 226.24 g/mol |
| IUPAC name | 1-(cyclohexen-1-yl)-4-(trifluoromethyl)benzene |
| InChIKey | ZHWZIUOJISTCRY-UHFFFAOYSA-N |
| SMILES | C1CCC(=CC1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)