cas: 10540-45-1 — see every product listed under this CAS number, including other names
4'-Fluoro-[1,1'-biphenyl]-3-amine, ≥95%, ≥95% (CAS 10540-45-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SCF-50mg |
| cas | 10540-45-1 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 803.60 Pln | |
| Chemat | 5g | 2512.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-(4-fluorophenyl)aniline (CAS 10540-45-1) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 3-(4-fluorophenyl)aniline. InChIKey: ILWUJLSKEHCTSA-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 3-(4-fluorophenyl)aniline |
| InChIKey | ILWUJLSKEHCTSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)