CAS 20784-60-5 appears in our catalog under these names: 4'-O-Methylbavachalcone/ 99.31% (existing batch purity), 4'-O-Methylbroussochalcone B, 95%, 95%, 4'-O-Methylbavachalcone, 99.64%, 2-Propen-1-one, 1-[2-hydroxy-4-methoxy-5-(3-methyl-2-buten-1-yl)phenyl]-3-(4-hydroxyphenyl)-, (2E)-, 95%. Offered by: TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
(E)-1-[2-hydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 20784-60-5) is a chemical compound with the molecular formula C22H24O4 and a molecular weight of 352.4 g/mol. IUPAC name: (E)-1-[2-hydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: GCEGUTHXMYHGKF-XYOKQWHBSA-N.
| Molecular formula | C22H24O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | (E)-1-[2-hydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | GCEGUTHXMYHGKF-XYOKQWHBSA-N |
| SMILES | CC(=CCC1=CC(=C(C=C1OC)O)C(=O)/C=C/C2=CC=C(C=C2)OC)C |
Computed by PubChem (NCBI)