cas: 59771-24-3 — see every product listed under this CAS number, including other names
4'-iso-Butylpropiophenone (CAS 59771-24-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F365483-100MG |
| cas | 59771-24-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1039.24 Pln |
| delivery time | 3-4 weeks |
|---|
1-[4-(2-methylpropyl)phenyl]propan-1-one (CAS 59771-24-3) is a chemical compound with the molecular formula C13H18O and a molecular weight of 190.28 g/mol. IUPAC name: 1-[4-(2-methylpropyl)phenyl]propan-1-one. InChIKey: GPZIKPBHFMNTOH-UHFFFAOYSA-N.
| Molecular formula | C13H18O |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | 1-[4-(2-methylpropyl)phenyl]propan-1-one |
| InChIKey | GPZIKPBHFMNTOH-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)CC(C)C |
Computed by PubChem (NCBI)