cas: 21873-51-8 — see every product listed under this CAS number, including other names
4(1H)-Quinolinone, 6-iodo-, 97%, 97% (CAS 21873-51-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BIQ7-100mg |
| cas | 21873-51-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 500mg | 1091.60 Pln | |
| Chemat | 1g | 1605.20 Pln | |
| Chemat | 5g | 4691.60 Pln | |
| Chemat | 10g | 8253.20 Pln | |
| Chemat | 25g | 16446.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-iodo-1H-quinolin-4-one (CAS 21873-51-8) is a chemical compound with the molecular formula C9H6INO and a molecular weight of 271.05 g/mol. IUPAC name: 6-iodo-1H-quinolin-4-one. InChIKey: ZAZOVHUNVUSQMU-UHFFFAOYSA-N.
| Molecular formula | C9H6INO |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 6-iodo-1H-quinolin-4-one |
| InChIKey | ZAZOVHUNVUSQMU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=O)C=CN2 |
Computed by PubChem (NCBI)