CAS 2438558-72-4 appears in our catalog under these names: Sodium 2,5-dichloro-4-oxo-4H-pyrimidin-3-ide, 97%, 2,5-dichloro-1H-pyrimidin-6-one sodium salt, 95%, 95%, 4(3H)-Pyrimidinone, 2,5-dichloro-, sodium salt (1:1), 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 1g.
CAS 2438558-72-4 identifies a chemical compound with the molecular formula C4H2Cl2N2NaO and a molecular weight of 187.96 g/mol. InChIKey: XIDQUYZQXGJXJM-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl2N2NaO |
|---|---|
| Molecular weight | 187.96 g/mol |
| InChIKey | XIDQUYZQXGJXJM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=N1)Cl)Cl.[Na] |
Computed by PubChem (NCBI)