4,4',4'',4'''-(Perylene-2,5,8,11-tetrayl)tetrabenzoic acid, 97%
cas: 1885094-82-5 — see every product listed under this CAS number, including other names
4,4',4'',4'''-(Perylene-2,5,8,11-tetrayl)tetrabenzoic acid, 97% (CAS 1885094-82-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1363902-250mg |
| cas | 1885094-82-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2901.31 Pln | |
| Ambeed | 1g | 7751.81 Pln | |
| BLDpharm | 50mg | 1080.76 Pln | |
| BLDpharm | 100mg | 1786.06 Pln | |
| BLDpharm | 250mg | 2841.25 Pln | |
| BLDpharm | 1g | 7595.13 Pln | |
| Chemat | 50mg | 813.20 Pln | |
| Chemat | 100mg | 1336.40 Pln | |
| Chemat | 250mg | 2229.20 Pln | |
| Chemat | 1g | 6779.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-[5,8,11-tris(4-carboxyphenyl)perylen-2-yl]benzoic acid (CAS 1885094-82-5) is a chemical compound with the molecular formula C48H28O8 and a molecular weight of 732.7 g/mol. IUPAC name: 4-[5,8,11-tris(4-carboxyphenyl)perylen-2-yl]benzoic acid. InChIKey: DTIZXLIEKUHXPB-UHFFFAOYSA-N.
| Molecular formula | C48H28O8 |
|---|---|
| Molecular weight | 732.7 g/mol |
| IUPAC name | 4-[5,8,11-tris(4-carboxyphenyl)perylen-2-yl]benzoic acid |
| InChIKey | DTIZXLIEKUHXPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=CC(=CC4=C3C(=C2)C5=CC(=CC6=CC(=CC4=C65)C7=CC=C(C=C7)C(=O)O)C8=CC=C(C=C8)C(=O)O)C9=CC=C(C=C9)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)