4,4',4''-(((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))tris(ethyne-2,1-diyl))trianiline, 98%
cas: 2803476-79-9 — see every product listed under this CAS number, including other names
4,4',4''-(((1,3,5-Triazine-2,4,6-triyl)tris(benzene-4,1-diyl))tris(ethyne-2,1-diyl))trianiline, 98% (CAS 2803476-79-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1489844-100mg |
| cas | 2803476-79-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 581.75 Pln | |
| Ambeed | 250mg | 971.12 Pln | |
| Ambeed | 1g | 2395.12 Pln | |
| Ambeed | 5g | 9359.38 Pln | |
| BLDpharm | 100mg | 569.82 Pln | |
| BLDpharm | 250mg | 953.02 Pln | |
| BLDpharm | 1g | 2346.98 Pln | |
| BLDpharm | 5g | 9177.90 Pln | |
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 1g | 1715.60 Pln | |
| Chemat | 5g | 6669.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-[2-[4-[4,6-bis[4-[2-(4-aminophenyl)ethynyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethynyl]aniline (CAS 2803476-79-9) is a chemical compound with the molecular formula C45H30N6 and a molecular weight of 654.8 g/mol. IUPAC name: 4-[2-[4-[4,6-bis[4-[2-(4-aminophenyl)ethynyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethynyl]aniline. InChIKey: QHXFNRMGDRODMG-UHFFFAOYSA-N.
| Molecular formula | C45H30N6 |
|---|---|
| Molecular weight | 654.8 g/mol |
| IUPAC name | 4-[2-[4-[4,6-bis[4-[2-(4-aminophenyl)ethynyl]phenyl]-1,3,5-triazin-2-yl]phenyl]ethynyl]aniline |
| InChIKey | QHXFNRMGDRODMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)N)C3=NC(=NC(=N3)C4=CC=C(C=C4)C#CC5=CC=C(C=C5)N)C6=CC=C(C=C6)C#CC7=CC=C(C=C7)N |
Computed by PubChem (NCBI)