4,4',4''-(Benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde, 98%
cas: 2289758-98-9 — see every product listed under this CAS number, including other names
4,4',4''-(Benzene-1,3,5-triyltris(ethyne-2,1-diyl))tribenzaldehyde, 98% (CAS 2289758-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1226415-100mg |
| cas | 2289758-98-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2884.62 Pln | |
| Ambeed | 10g | 4581.19 Pln | |
| BLDpharm | 100mg | 164.41 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 3107.82 Pln | |
| BLDpharm | 10g | 4929.40 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 352.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-[2-[3,5-bis[2-(4-formylphenyl)ethynyl]phenyl]ethynyl]benzaldehyde (CAS 2289758-98-9) is a chemical compound with the molecular formula C33H18O3 and a molecular weight of 462.5 g/mol. IUPAC name: 4-[2-[3,5-bis[2-(4-formylphenyl)ethynyl]phenyl]ethynyl]benzaldehyde. InChIKey: RSQZINMBNWLMKM-UHFFFAOYSA-N.
| Molecular formula | C33H18O3 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | 4-[2-[3,5-bis[2-(4-formylphenyl)ethynyl]phenyl]ethynyl]benzaldehyde |
| InChIKey | RSQZINMBNWLMKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C#CC2=CC(=CC(=C2)C#CC3=CC=C(C=C3)C=O)C#CC4=CC=C(C=C4)C=O |
Computed by PubChem (NCBI)