CAS 4466-18-6 is the registry number for 4,4',4''-(Benzene-1,3,5-triyltris(propane-2,2-diyl))triphenol, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
4-[2-[3,5-bis[2-(4-hydroxyphenyl)propan-2-yl]phenyl]propan-2-yl]phenol (CAS 4466-18-6) is a chemical compound with the molecular formula C33H36O3 and a molecular weight of 480.6 g/mol. IUPAC name: 4-[2-[3,5-bis[2-(4-hydroxyphenyl)propan-2-yl]phenyl]propan-2-yl]phenol. InChIKey: PREWTCFQARLUPB-UHFFFAOYSA-N.
| Molecular formula | C33H36O3 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | 4-[2-[3,5-bis[2-(4-hydroxyphenyl)propan-2-yl]phenyl]propan-2-yl]phenol |
| InChIKey | PREWTCFQARLUPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC(=CC(=C2)C(C)(C)C3=CC=C(C=C3)O)C(C)(C)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)