4,4',4''-(Pyrimidine-2,4,6-triyl)trianiline, 97%
cas: 136009-19-3 — see every product listed under this CAS number, including other names
4,4',4''-(Pyrimidine-2,4,6-triyl)trianiline, 97% (CAS 136009-19-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1462840-100mg |
| cas | 136009-19-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 570.62 Pln | |
| Ambeed | 1g | 1416.12 Pln | |
| Ambeed | 5g | 4903.81 Pln | |
| BLDpharm | 100mg | 364.34 Pln | |
| BLDpharm | 250mg | 564.27 Pln | |
| BLDpharm | 1g | 1408.42 Pln | |
| BLDpharm | 5g | 4751.68 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1384.40 Pln | |
| Chemat | 5g | 4686.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline (CAS 136009-19-3) is a chemical compound with the molecular formula C22H19N5 and a molecular weight of 353.4 g/mol. IUPAC name: 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline. InChIKey: OQDMEZSPCAZIQE-UHFFFAOYSA-N.
| Molecular formula | C22H19N5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline |
| InChIKey | OQDMEZSPCAZIQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC(=N2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
Computed by PubChem (NCBI)