cas: 74774-61-1 — see every product listed under this CAS number, including other names
4,4'-(Decane-1,10-diylbis(oxy))dibenzoic acid, ≥97%, ≥97% (CAS 74774-61-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D86-250mg |
| cas | 74774-61-1 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 933.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
4-[10-(4-carboxyphenoxy)decoxy]benzoic acid (CAS 74774-61-1) is a chemical compound with the molecular formula C24H30O6 and a molecular weight of 414.5 g/mol. IUPAC name: 4-[10-(4-carboxyphenoxy)decoxy]benzoic acid. InChIKey: XRDKWFXOXXUQJS-UHFFFAOYSA-N.
| Molecular formula | C24H30O6 |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | 4-[10-(4-carboxyphenoxy)decoxy]benzoic acid |
| InChIKey | XRDKWFXOXXUQJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCCCCCCCCCCOC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)