cas: 2479-47-2 — see every product listed under this CAS number, including other names
4,4'-(Propane-2,2-diyl)dianiline, 98%, 98% (CAS 2479-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PFP-100mg |
| cas | 2479-47-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 467.60 Pln | |
| Chemat | 10g | 870.80 Pln | |
| Chemat | 25g | 2080.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[2-(4-aminophenyl)propan-2-yl]aniline (CAS 2479-47-2) is a chemical compound with the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. IUPAC name: 4-[2-(4-aminophenyl)propan-2-yl]aniline. InChIKey: ZYEDGEXYGKWJPB-UHFFFAOYSA-N.
| Molecular formula | C15H18N2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | 4-[2-(4-aminophenyl)propan-2-yl]aniline |
| InChIKey | ZYEDGEXYGKWJPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)N)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)