cas: 475480-90-1 — see every product listed under this CAS number, including other names
4,4'-Bis(2-(9-ethyl-9H-carbazol-3-yl)vinyl)-1,1'-biphenyl, 95% mix TBC as stabilizer, 95% mix TBC as stabilizer (CAS 475480-90-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9O3-100mg |
| cas | 475480-90-1 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln |
| purity | 95% mix TBC as stabilizer |
|---|---|
| delivery time | 3 weeks |
9-ethyl-3-[(E)-2-[4-[4-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]phenyl]phenyl]ethenyl]carbazole (CAS 475480-90-1) is a chemical compound with the molecular formula C44H36N2 and a molecular weight of 592.8 g/mol. IUPAC name: 9-ethyl-3-[(E)-2-[4-[4-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]phenyl]phenyl]ethenyl]carbazole. InChIKey: RAPHUPWIHDYTKU-WXUKJITCSA-N.
| Molecular formula | C44H36N2 |
|---|---|
| Molecular weight | 592.8 g/mol |
| IUPAC name | 9-ethyl-3-[(E)-2-[4-[4-[(E)-2-(9-ethylcarbazol-3-yl)ethenyl]phenyl]phenyl]ethenyl]carbazole |
| InChIKey | RAPHUPWIHDYTKU-WXUKJITCSA-N |
| SMILES | CCN1C2=CC=CC=C2C3=C1C=CC(=C3)/C=C/C4=CC=C(C=C4)C5=CC=C(C=C5)/C=C/C6=CC7=C(N(C8=CC=CC=C78)CC)C=C6 |
Computed by PubChem (NCBI)