cas: 119586-44-6 — see every product listed under this CAS number, including other names
4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl (CAS 119586-44-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111IZG-100mg |
| cas | 119586-44-6 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 250mg | 405.20 Pln |
| delivery time | 3 weeks |
|---|
4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline (CAS 119586-44-6) is a chemical compound with the molecular formula C56H48N2 and a molecular weight of 749.0 g/mol. IUPAC name: 4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline. InChIKey: OSQXTXTYKAEHQV-WXUKJITCSA-N.
| Molecular formula | C56H48N2 |
|---|---|
| Molecular weight | 749.0 g/mol |
| IUPAC name | 4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline |
| InChIKey | OSQXTXTYKAEHQV-WXUKJITCSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)/C=C/C3=CC=C(C=C3)C4=CC=C(C=C4)/C=C/C5=CC=C(C=C5)N(C6=CC=C(C=C6)C)C7=CC=C(C=C7)C)C8=CC=C(C=C8)C |
Computed by PubChem (NCBI)