CAS 3085-42-5 appears in our catalog under these names: 4–Chlorophenyl Sulfoxide, 4-Chlorophenyl Sulfoxide, >98.0%(GC), 4,4'-Sulfinylbis(chlorobenzene), 95%, 95%, 4-Chlorophenyl Sulfoxide, 4,4'-Dichlordiphenylsulfoxid, 95%. Offered by: GLPBio, TCI, Chemat, HPC Standards, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1x1000mg.
1-chloro-4-(4-chlorophenyl)sulfinylbenzene (CAS 3085-42-5) is a chemical compound with the molecular formula C12H8Cl2OS and a molecular weight of 271.2 g/mol. IUPAC name: 1-chloro-4-(4-chlorophenyl)sulfinylbenzene. InChIKey: KJGYFISADIZFEL-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2OS |
|---|---|
| Molecular weight | 271.2 g/mol |
| IUPAC name | 1-chloro-4-(4-chlorophenyl)sulfinylbenzene |
| InChIKey | KJGYFISADIZFEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)