cas: 18511-72-3 — see every product listed under this CAS number, including other names
4,4'-Dinitro-2,2'-bipyridine, 95% (CAS 18511-72-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243715-250MG |
| cas | 18511-72-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1315.18 Pln | |
| Fluorochem | 10g | 2569.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-nitro-2-(4-nitro-2-pyridinyl)pyridine (CAS 18511-72-3) is a chemical compound with the molecular formula C10H6N4O4 and a molecular weight of 246.18 g/mol. IUPAC name: 4-nitro-2-(4-nitro-2-pyridinyl)pyridine. InChIKey: ULRVNIRBWWMQJT-UHFFFAOYSA-N.
| Molecular formula | C10H6N4O4 |
|---|---|
| Molecular weight | 246.18 g/mol |
| IUPAC name | 4-nitro-2-(4-nitro-2-pyridinyl)pyridine |
| InChIKey | ULRVNIRBWWMQJT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])C2=NC=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)