4,4'-Disulfanediyldibenzonitrile, 98%
cas: 6339-51-1 — see every product listed under this CAS number, including other names
4,4'-Disulfanediyldibenzonitrile, 98% (CAS 6339-51-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A180306-250mg |
| cas | 6339-51-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 2078.06 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 429.20 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 614.25 Pln | |
| BLDpharm | 5g | 2235.90 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 586.27 Pln | |
| Fluorochem | 5g | 2137.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-[(4-cyanophenyl)disulfanyl]benzonitrile (CAS 6339-51-1) is a chemical compound with the molecular formula C14H8N2S2 and a molecular weight of 268.4 g/mol. IUPAC name: 4-[(4-cyanophenyl)disulfanyl]benzonitrile. InChIKey: BCUVQZBVGSXWCG-UHFFFAOYSA-N.
| Molecular formula | C14H8N2S2 |
|---|---|
| Molecular weight | 268.4 g/mol |
| IUPAC name | 4-[(4-cyanophenyl)disulfanyl]benzonitrile |
| InChIKey | BCUVQZBVGSXWCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)SSC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)